C17H17ClF3N5S — CID 2795606
4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N-pyridin-3-yl-1,4-diazepane-1-carbothioamide (PubChem CID 2795606) has the molecular formula C17H17ClF3N5S and a molecular weight of 415.87 g/mol. Its IUPAC name is 4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N-pyridin-3-yl-1,4-diazepane-1-carbothioamide.
| Compound Name | 4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N-pyridin-3-yl-1,4-diazepane-1-carbothioamide |
|---|---|
| PubChem CID | 2795606 |
| Molecular Formula | C17H17ClF3N5S |
| Molecular Weight | 415.87 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | 4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N-pyridin-3-yl-1,4-diazepane-1-carbothioamide |
| SMILES | FC(F)(F)c1cnc(N2CCCN(C(=S)Nc3cccnc3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C17H17ClF3N5S/c18-14-9-12(17(19,20)21)10-23-15(14)25-5-2-6-26(8-7-25)16(27)24-13-3-1-4-22-11-13/h1,3-4,9-11H,2,5-8H2,(H,24,27) |
| InChIKey | BGWMAYIIVOUMFY-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.87 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|