C17H18ClF3N5S+ — CID 7037019
4-[3-chloro-5-(trifluoromethyl)pyridin-1-ium-2-yl]-N-pyridin-3-yl-1,4-diazepane-1-carbothioamide (PubChem CID 7037019) has the molecular formula C17H18ClF3N5S+ and a molecular weight of 416.88 g/mol. Its IUPAC name is 4-[3-chloro-5-(trifluoromethyl)pyridin-1-ium-2-yl]-N-pyridin-3-yl-1,4-diazepane-1-carbothioamide.
| Compound Name | 4-[3-chloro-5-(trifluoromethyl)pyridin-1-ium-2-yl]-N-pyridin-3-yl-1,4-diazepane-1-carbothioamide |
|---|---|
| PubChem CID | 7037019 |
| Molecular Formula | C17H18ClF3N5S+ |
| Molecular Weight | 416.88 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 4-[3-chloro-5-(trifluoromethyl)pyridin-1-ium-2-yl]-N-pyridin-3-yl-1,4-diazepane-1-carbothioamide |
| SMILES | FC(F)(F)c1c[nH+]c(N2CCCN(C(=S)Nc3cccnc3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C17H17ClF3N5S/c18-14-9-12(17(19,20)21)10-23-15(14)25-5-2-6-26(8-7-25)16(27)24-13-3-1-4-22-11-13/h1,3-4,9-11H,2,5-8H2,(H,24,27)/p+1 |
| InChIKey | BGWMAYIIVOUMFY-UHFFFAOYSA-O |
| XLogP | 3.48 |
| TPSA | 45.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.88 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|