C16H23ClF3N4S+ — CID 7222272
4-[3-chloro-5-(trifluoromethyl)pyridin-1-ium-2-yl]-N-[(2R)-2-methylbutyl]piperazine-1-carbothioamide (PubChem CID 7222272) has the molecular formula C16H23ClF3N4S+ and a molecular weight of 395.90 g/mol. Its IUPAC name is 4-[3-chloro-5-(trifluoromethyl)pyridin-1-ium-2-yl]-N-[(2R)-2-methylbutyl]piperazine-1-carbothioamide.
| Compound Name | 4-[3-chloro-5-(trifluoromethyl)pyridin-1-ium-2-yl]-N-[(2R)-2-methylbutyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 7222272 |
| Molecular Formula | C16H23ClF3N4S+ |
| Molecular Weight | 395.90 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 4-[3-chloro-5-(trifluoromethyl)pyridin-1-ium-2-yl]-N-[(2R)-2-methylbutyl]piperazine-1-carbothioamide |
| SMILES | CC[C@@H](C)CNC(=S)N1CCN(c2[nH+]cc(C(F)(F)F)cc2Cl)CC1 |
| InChI | InChI=1S/C16H22ClF3N4S/c1-3-11(2)9-22-15(25)24-6-4-23(5-7-24)14-13(17)8-12(10-21-14)16(18,19)20/h8,10-11H,3-7,9H2,1-2H3,(H,22,25)/p+1/t11-/m1/s1 |
| InChIKey | QCSGFMSHOCQNLY-LLVKDONJSA-O |
| XLogP | 3.22 |
| TPSA | 32.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.90 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|