C18H19ClF3N4S+ — CID 7222253
N-benzyl-4-[3-chloro-5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazine-1-carbothioamide (PubChem CID 7222253) has the molecular formula C18H19ClF3N4S+ and a molecular weight of 415.89 g/mol. Its IUPAC name is N-benzyl-4-[3-chloro-5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazine-1-carbothioamide.
| Compound Name | N-benzyl-4-[3-chloro-5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 7222253 |
| Molecular Formula | C18H19ClF3N4S+ |
| Molecular Weight | 415.89 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | N-benzyl-4-[3-chloro-5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazine-1-carbothioamide |
| SMILES | FC(F)(F)c1c[nH+]c(N2CCN(C(=S)NCc3ccccc3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C18H18ClF3N4S/c19-15-10-14(18(20,21)22)12-23-16(15)25-6-8-26(9-7-25)17(27)24-11-13-4-2-1-3-5-13/h1-5,10,12H,6-9,11H2,(H,24,27)/p+1 |
| InChIKey | VBNTYDSJLTWWID-UHFFFAOYSA-O |
| XLogP | 3.37 |
| TPSA | 32.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.89 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|