C14H13ClF3N3O3 — CID 7222243
(E)-4-[4-[3-chloro-5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-yl]-4-oxobut-2-enoate (PubChem CID 7222243) has the molecular formula C14H13ClF3N3O3 and a molecular weight of 363.72 g/mol. Its IUPAC name is (E)-4-[4-[3-chloro-5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-yl]-4-oxobut-2-enoate.
| Compound Name | (E)-4-[4-[3-chloro-5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-yl]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 7222243 |
| Molecular Formula | C14H13ClF3N3O3 |
| Molecular Weight | 363.72 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | (E)-4-[4-[3-chloro-5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-yl]-4-oxobut-2-enoate |
| SMILES | O=C([O-])/C=C/C(=O)N1CCN(c2[nH+]cc(C(F)(F)F)cc2Cl)CC1 |
| InChI | InChI=1S/C14H13ClF3N3O3/c15-10-7-9(14(16,17)18)8-19-13(10)21-5-3-20(4-6-21)11(22)1-2-12(23)24/h1-2,7-8H,3-6H2,(H,23,24)/b2-1+ |
| InChIKey | PKHDKPNVSFNUBY-OWOJBTEDSA-N |
| XLogP | 0.13 |
| TPSA | 77.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.72 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|