C16H15ClF3N4O+ — CID 9366623
[4-[3-chloro-5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-yl]-pyridin-2-ylmethanone (PubChem CID 9366623) has the molecular formula C16H15ClF3N4O+ and a molecular weight of 371.77 g/mol. Its IUPAC name is [4-[3-chloro-5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-yl]-pyridin-2-ylmethanone.
| Compound Name | [4-[3-chloro-5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-yl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 9366623 |
| Molecular Formula | C16H15ClF3N4O+ |
| Molecular Weight | 371.77 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | [4-[3-chloro-5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-yl]-pyridin-2-ylmethanone |
| SMILES | O=C(c1ccccn1)N1CCN(c2[nH+]cc(C(F)(F)F)cc2Cl)CC1 |
| InChI | InChI=1S/C16H14ClF3N4O/c17-12-9-11(16(18,19)20)10-22-14(12)23-5-7-24(8-6-23)15(25)13-3-1-2-4-21-13/h1-4,9-10H,5-8H2/p+1 |
| InChIKey | ONAJLFGSWBAXHL-UHFFFAOYSA-O |
| XLogP | 2.53 |
| TPSA | 50.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.77 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |