C11H6BrF3N4O2S — CID 2797465
6-(4-nitrophenyl)-2-(trifluoromethyl)imidazo[2,1-b][1,3,4]thiadiazole;hydrobromide (PubChem CID 2797465) has the molecular formula C11H6BrF3N4O2S and a molecular weight of 395.16 g/mol. Its IUPAC name is 6-(4-nitrophenyl)-2-(trifluoromethyl)imidazo[2,1-b][1,3,4]thiadiazole;hydrobromide.
| Compound Name | 6-(4-nitrophenyl)-2-(trifluoromethyl)imidazo[2,1-b][1,3,4]thiadiazole;hydrobromide |
|---|---|
| PubChem CID | 2797465 |
| Molecular Formula | C11H6BrF3N4O2S |
| Molecular Weight | 395.16 g/mol |
| Exact Mass | 393.93 |
| IUPAC Name | 6-(4-nitrophenyl)-2-(trifluoromethyl)imidazo[2,1-b][1,3,4]thiadiazole;hydrobromide |
| SMILES | Br.O=[N+]([O-])c1ccc(-c2cn3nc(C(F)(F)F)sc3n2)cc1 |
| InChI | InChI=1S/C11H5F3N4O2S.BrH/c12-11(13,14)9-16-17-5-8(15-10(17)21-9)6-1-3-7(4-2-6)18(19)20;/h1-5H;1H |
| InChIKey | VVTBOHSMLAHEJA-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.16 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|