C11H10N4S — CID 576560
4-(2-methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)aniline (PubChem CID 576560) has the molecular formula C11H10N4S and a molecular weight of 230.30 g/mol. Its IUPAC name is 4-(2-methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)aniline.
| Compound Name | 4-(2-methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)aniline |
|---|---|
| PubChem CID | 576560 |
| Molecular Formula | C11H10N4S |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 4-(2-methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)aniline |
| SMILES | Cc1nn2cc(-c3ccc(N)cc3)nc2s1 |
| InChI | InChI=1S/C11H10N4S/c1-7-14-15-6-10(13-11(15)16-7)8-2-4-9(12)5-3-8/h2-6H,12H2,1H3 |
| InChIKey | ZGDQAQZRJZDYMQ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|