C17H18F3N3OS — CID 2798061
1-(2-pyridin-4-ylethyl)-3-[[3-(trifluoromethyl)phenyl]methylsulfanylmethyl]urea (PubChem CID 2798061) has the molecular formula C17H18F3N3OS and a molecular weight of 369.41 g/mol. Its IUPAC name is 1-(2-pyridin-4-ylethyl)-3-[[3-(trifluoromethyl)phenyl]methylsulfanylmethyl]urea.
| Compound Name | 1-(2-pyridin-4-ylethyl)-3-[[3-(trifluoromethyl)phenyl]methylsulfanylmethyl]urea |
|---|---|
| PubChem CID | 2798061 |
| Molecular Formula | C17H18F3N3OS |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 1-(2-pyridin-4-ylethyl)-3-[[3-(trifluoromethyl)phenyl]methylsulfanylmethyl]urea |
| SMILES | O=C(NCCc1ccncc1)NCSCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H18F3N3OS/c18-17(19,20)15-3-1-2-14(10-15)11-25-12-23-16(24)22-9-6-13-4-7-21-8-5-13/h1-5,7-8,10H,6,9,11-12H2,(H2,22,23,24) |
| InChIKey | BXWYLLOOJINAQT-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|