C22H31N5O3 — CID 27994543
ethyl 4-[2-[(3-tert-butyl-1-phenylpyrazol-5-yl)amino]-2-oxoethyl]piperazine-1-carboxylate (PubChem CID 27994543) has the molecular formula C22H31N5O3 and a molecular weight of 413.52 g/mol. Its IUPAC name is ethyl 4-[2-[(3-tert-butyl-1-phenylpyrazol-5-yl)amino]-2-oxoethyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-[(3-tert-butyl-1-phenylpyrazol-5-yl)amino]-2-oxoethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 27994543 |
| Molecular Formula | C22H31N5O3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | ethyl 4-[2-[(3-tert-butyl-1-phenylpyrazol-5-yl)amino]-2-oxoethyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(CC(=O)Nc2cc(C(C)(C)C)nn2-c2ccccc2)CC1 |
| InChI | InChI=1S/C22H31N5O3/c1-5-30-21(29)26-13-11-25(12-14-26)16-20(28)23-19-15-18(22(2,3)4)24-27(19)17-9-7-6-8-10-17/h6-10,15H,5,11-14,16H2,1-4H3,(H,23,28) |
| InChIKey | XSRGEDSGYUUMDY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |