C19H19F2NO2 — CID 2799902
[1-(3,4-difluorophenyl)ethylideneamino] 4-tert-butylbenzoate (PubChem CID 2799902) has the molecular formula C19H19F2NO2 and a molecular weight of 331.36 g/mol. Its IUPAC name is [1-(3,4-difluorophenyl)ethylideneamino] 4-tert-butylbenzoate.
| Compound Name | [1-(3,4-difluorophenyl)ethylideneamino] 4-tert-butylbenzoate |
|---|---|
| PubChem CID | 2799902 |
| Molecular Formula | C19H19F2NO2 |
| Molecular Weight | 331.36 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | [1-(3,4-difluorophenyl)ethylideneamino] 4-tert-butylbenzoate |
| SMILES | CC(=NOC(=O)c1ccc(C(C)(C)C)cc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H19F2NO2/c1-12(14-7-10-16(20)17(21)11-14)22-24-18(23)13-5-8-15(9-6-13)19(2,3)4/h5-11H,1-4H3 |
| InChIKey | AIAPFKPYVQXALU-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.36 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|