C21H18N2O7 — CID 2800106
5-(4H-1,3-benzodioxin-6-ylamino)-2-(1,3-dioxoisoindol-2-yl)-5-oxopentanoic acid (PubChem CID 2800106) has the molecular formula C21H18N2O7 and a molecular weight of 410.38 g/mol. Its IUPAC name is 5-(4H-1,3-benzodioxin-6-ylamino)-2-(1,3-dioxoisoindol-2-yl)-5-oxopentanoic acid.
| Compound Name | 5-(4H-1,3-benzodioxin-6-ylamino)-2-(1,3-dioxoisoindol-2-yl)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 2800106 |
| Molecular Formula | C21H18N2O7 |
| Molecular Weight | 410.38 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | 5-(4H-1,3-benzodioxin-6-ylamino)-2-(1,3-dioxoisoindol-2-yl)-5-oxopentanoic acid |
| SMILES | O=C(CCC(C(=O)O)N1C(=O)c2ccccc2C1=O)Nc1ccc2c(c1)COCO2 |
| InChI | InChI=1S/C21H18N2O7/c24-18(22-13-5-7-17-12(9-13)10-29-11-30-17)8-6-16(21(27)28)23-19(25)14-3-1-2-4-15(14)20(23)26/h1-5,7,9,16H,6,8,10-11H2,(H,22,24)(H,27,28) |
| InChIKey | PTBUGUXRRPKHNB-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|