C16H12Br3N3O6 — CID 2800369
2,6-dimethoxy-3-nitro-N-[(2,4,6-tribromophenyl)carbamoyl]benzamide (PubChem CID 2800369) has the molecular formula C16H12Br3N3O6 and a molecular weight of 582.00 g/mol. Its IUPAC name is 2,6-dimethoxy-3-nitro-N-[(2,4,6-tribromophenyl)carbamoyl]benzamide.
| Compound Name | 2,6-dimethoxy-3-nitro-N-[(2,4,6-tribromophenyl)carbamoyl]benzamide |
|---|---|
| PubChem CID | 2800369 |
| Molecular Formula | C16H12Br3N3O6 |
| Molecular Weight | 582.00 g/mol |
| Exact Mass | 578.83 |
| IUPAC Name | 2,6-dimethoxy-3-nitro-N-[(2,4,6-tribromophenyl)carbamoyl]benzamide |
| SMILES | COc1ccc([N+](=O)[O-])c(OC)c1C(=O)NC(=O)Nc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C16H12Br3N3O6/c1-27-11-4-3-10(22(25)26)14(28-2)12(11)15(23)21-16(24)20-13-8(18)5-7(17)6-9(13)19/h3-6H,1-2H3,(H2,20,21,23,24) |
| InChIKey | SQRCLEHWKYSXOK-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.00 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|