C18H16Br2N2O6 — CID 68820138
methyl 3,5-dibromo-2-[2-(4-methoxy-3-nitrophenyl)propanoylamino]benzoate (PubChem CID 68820138) has the molecular formula C18H16Br2N2O6 and a molecular weight of 516.14 g/mol. Its IUPAC name is methyl 3,5-dibromo-2-[2-(4-methoxy-3-nitrophenyl)propanoylamino]benzoate.
| Compound Name | methyl 3,5-dibromo-2-[2-(4-methoxy-3-nitrophenyl)propanoylamino]benzoate |
|---|---|
| PubChem CID | 68820138 |
| Molecular Formula | C18H16Br2N2O6 |
| Molecular Weight | 516.14 g/mol |
| Exact Mass | 513.94 |
| IUPAC Name | methyl 3,5-dibromo-2-[2-(4-methoxy-3-nitrophenyl)propanoylamino]benzoate |
| SMILES | COC(=O)c1cc(Br)cc(Br)c1NC(=O)C(C)c1ccc(OC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H16Br2N2O6/c1-9(10-4-5-15(27-2)14(6-10)22(25)26)17(23)21-16-12(18(24)28-3)7-11(19)8-13(16)20/h4-9H,1-3H3,(H,21,23) |
| InChIKey | ATHNTBSETDYTDB-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.14 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|