C20H26 — CID 2801638
4,7-ditert-butyl-1,2-dihydroacenaphthylene (PubChem CID 2801638) has the molecular formula C20H26 and a molecular weight of 266.43 g/mol. Its IUPAC name is 4,7-ditert-butyl-1,2-dihydroacenaphthylene.
| Compound Name | 4,7-ditert-butyl-1,2-dihydroacenaphthylene |
|---|---|
| PubChem CID | 2801638 |
| Molecular Formula | C20H26 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | 4,7-ditert-butyl-1,2-dihydroacenaphthylene |
| SMILES | CC(C)(C)c1cc2c3c(cc(C(C)(C)C)cc3c1)CC2 |
| InChI | InChI=1S/C20H26/c1-19(2,3)16-9-13-7-8-14-10-17(20(4,5)6)12-15(11-16)18(13)14/h9-12H,7-8H2,1-6H3 |
| InChIKey | QSKBIWMIBNANPR-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |