About 4,7-ditert-butyl-1,2-dihydroacenaphthylene
4,7-ditert-butyl-1,2-dihydroacenaphthylene (PubChem CID 2801638) has the molecular formula C20H26
and a molecular weight of 266.43 g/mol. Its IUPAC name is 4,7-ditert-butyl-1,2-dihydroacenaphthylene.
Molecular Properties
| Compound Name | 4,7-ditert-butyl-1,2-dihydroacenaphthylene |
| PubChem CID | 2801638 |
| Molecular Formula | C20H26 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | 4,7-ditert-butyl-1,2-dihydroacenaphthylene |
| SMILES | CC(C)(C)c1cc2c3c(cc(C(C)(C)C)cc3c1)CC2 |
| InChI | InChI=1S/C20H26/c1-19(2,3)16-9-13-7-8-14-10-17(20(4,5)6)12-15(11-16)18(13)14/h9-12H,7-8H2,1-6H3 |
| InChIKey | QSKBIWMIBNANPR-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4,7-ditert-butyl-1,2-dihydroacenaphthylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-ditert-butyl-1,2-dihydroacenaphthylene?
The IUPAC name of 4,7-ditert-butyl-1,2-dihydroacenaphthylene (CID 2801638) is 4,7-ditert-butyl-1,2-dihydroacenaphthylene.
What is the SMILES notation for 4,7-ditert-butyl-1,2-dihydroacenaphthylene?
The canonical SMILES for 4,7-ditert-butyl-1,2-dihydroacenaphthylene is CC(C)(C)c1cc2c3c(cc(C(C)(C)C)cc3c1)CC2.
What is the InChIKey of 4,7-ditert-butyl-1,2-dihydroacenaphthylene?
The InChIKey is QSKBIWMIBNANPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26/c1-19(2,3)16-9-13-7-8-14-10-17(20(4,5)6)12-15(11-16)18(13)14/h9-12H,7-8H2,1-6H3.
What are the key properties of 4,7-ditert-butyl-1,2-dihydroacenaphthylene?
4,7-ditert-butyl-1,2-dihydroacenaphthylene has a molecular weight of 266.43 g/mol, XLogP of 5.53, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-ditert-butyl-1,2-dihydroacenaphthylene is sourced from PubChem (CID 2801638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).