C8H17NO4S2 — CID 2802499
N,N-diethyl-1,1-dioxothiolane-3-sulfonamide (PubChem CID 2802499) has the molecular formula C8H17NO4S2 and a molecular weight of 255.36 g/mol. Its IUPAC name is N,N-diethyl-1,1-dioxothiolane-3-sulfonamide.
| Compound Name | N,N-diethyl-1,1-dioxothiolane-3-sulfonamide |
|---|---|
| PubChem CID | 2802499 |
| Molecular Formula | C8H17NO4S2 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | N,N-diethyl-1,1-dioxothiolane-3-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H17NO4S2/c1-3-9(4-2)15(12,13)8-5-6-14(10,11)7-8/h8H,3-7H2,1-2H3 |
| InChIKey | JCVYBNNWFCKBBI-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |