C8H8BrCl2NO2S2 — CID 2805381
1-(4-bromo-2,5-dichlorothiophen-3-yl)sulfonylpyrrolidine (PubChem CID 2805381) has the molecular formula C8H8BrCl2NO2S2 and a molecular weight of 365.10 g/mol. Its IUPAC name is 1-(4-bromo-2,5-dichlorothiophen-3-yl)sulfonylpyrrolidine.
| Compound Name | 1-(4-bromo-2,5-dichlorothiophen-3-yl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 2805381 |
| Molecular Formula | C8H8BrCl2NO2S2 |
| Molecular Weight | 365.10 g/mol |
| Exact Mass | 362.86 |
| IUPAC Name | 1-(4-bromo-2,5-dichlorothiophen-3-yl)sulfonylpyrrolidine |
| SMILES | O=S(=O)(c1c(Cl)sc(Cl)c1Br)N1CCCC1 |
| InChI | InChI=1S/C8H8BrCl2NO2S2/c9-5-6(8(11)15-7(5)10)16(13,14)12-3-1-2-4-12/h1-4H2 |
| InChIKey | HFKBBEYOIHRJQW-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.10 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |