C15H15BrCl2N2O3S2 — CID 23854150
1-(4-bromo-2,5-dichlorothiophen-3-yl)sulfonyl-4-(3-methoxyphenyl)piperazine (PubChem CID 23854150) has the molecular formula C15H15BrCl2N2O3S2 and a molecular weight of 486.24 g/mol. Its IUPAC name is 1-(4-bromo-2,5-dichlorothiophen-3-yl)sulfonyl-4-(3-methoxyphenyl)piperazine.
| Compound Name | 1-(4-bromo-2,5-dichlorothiophen-3-yl)sulfonyl-4-(3-methoxyphenyl)piperazine |
|---|---|
| PubChem CID | 23854150 |
| Molecular Formula | C15H15BrCl2N2O3S2 |
| Molecular Weight | 486.24 g/mol |
| Exact Mass | 483.91 |
| IUPAC Name | 1-(4-bromo-2,5-dichlorothiophen-3-yl)sulfonyl-4-(3-methoxyphenyl)piperazine |
| SMILES | COc1cccc(N2CCN(S(=O)(=O)c3c(Cl)sc(Cl)c3Br)CC2)c1 |
| InChI | InChI=1S/C15H15BrCl2N2O3S2/c1-23-11-4-2-3-10(9-11)19-5-7-20(8-6-19)25(21,22)13-12(16)14(17)24-15(13)18/h2-4,9H,5-8H2,1H3 |
| InChIKey | QHSLDRCDUXYOEV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.24 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |