C16H17BrCl2N2O3S2 — CID 3667713
1-(4-bromo-2,5-dichlorothiophen-3-yl)sulfonyl-4-(4-ethoxyphenyl)piperazine (PubChem CID 3667713) has the molecular formula C16H17BrCl2N2O3S2 and a molecular weight of 500.27 g/mol. Its IUPAC name is 1-(4-bromo-2,5-dichlorothiophen-3-yl)sulfonyl-4-(4-ethoxyphenyl)piperazine.
| Compound Name | 1-(4-bromo-2,5-dichlorothiophen-3-yl)sulfonyl-4-(4-ethoxyphenyl)piperazine |
|---|---|
| PubChem CID | 3667713 |
| Molecular Formula | C16H17BrCl2N2O3S2 |
| Molecular Weight | 500.27 g/mol |
| Exact Mass | 497.92 |
| IUPAC Name | 1-(4-bromo-2,5-dichlorothiophen-3-yl)sulfonyl-4-(4-ethoxyphenyl)piperazine |
| SMILES | CCOc1ccc(N2CCN(S(=O)(=O)c3c(Cl)sc(Cl)c3Br)CC2)cc1 |
| InChI | InChI=1S/C16H17BrCl2N2O3S2/c1-2-24-12-5-3-11(4-6-12)20-7-9-21(10-8-20)26(22,23)14-13(17)15(18)25-16(14)19/h3-6H,2,7-10H2,1H3 |
| InChIKey | FJNJDWISMCKPMC-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.27 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|