C12H15Cl2NO2S — CID 2806415
1-(2,5-dichlorophenyl)sulfonyl-3-methylpiperidine (PubChem CID 2806415) has the molecular formula C12H15Cl2NO2S and a molecular weight of 308.23 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)sulfonyl-3-methylpiperidine.
| Compound Name | 1-(2,5-dichlorophenyl)sulfonyl-3-methylpiperidine |
|---|---|
| PubChem CID | 2806415 |
| Molecular Formula | C12H15Cl2NO2S |
| Molecular Weight | 308.23 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | 1-(2,5-dichlorophenyl)sulfonyl-3-methylpiperidine |
| SMILES | CC1CCCN(S(=O)(=O)c2cc(Cl)ccc2Cl)C1 |
| InChI | InChI=1S/C12H15Cl2NO2S/c1-9-3-2-6-15(8-9)18(16,17)12-7-10(13)4-5-11(12)14/h4-5,7,9H,2-3,6,8H2,1H3 |
| InChIKey | XTRHTVZAXYPHKZ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.23 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |