C13H15Cl2N3O2S — CID 2576672
3-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]propanenitrile (PubChem CID 2576672) has the molecular formula C13H15Cl2N3O2S and a molecular weight of 348.26 g/mol. Its IUPAC name is 3-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]propanenitrile.
| Compound Name | 3-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]propanenitrile |
|---|---|
| PubChem CID | 2576672 |
| Molecular Formula | C13H15Cl2N3O2S |
| Molecular Weight | 348.26 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | 3-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]propanenitrile |
| SMILES | N#CCCN1CCN(S(=O)(=O)c2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C13H15Cl2N3O2S/c14-11-2-3-12(15)13(10-11)21(19,20)18-8-6-17(7-9-18)5-1-4-16/h2-3,10H,1,5-9H2 |
| InChIKey | WLXSWTHEMROBJM-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |