C11H13Cl2NO2S — CID 691910
1-(2,3-dichlorophenyl)sulfonylpiperidine (PubChem CID 691910) has the molecular formula C11H13Cl2NO2S and a molecular weight of 294.20 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)sulfonylpiperidine.
| Compound Name | 1-(2,3-dichlorophenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 691910 |
| Molecular Formula | C11H13Cl2NO2S |
| Molecular Weight | 294.20 g/mol |
| Exact Mass | 293.00 |
| IUPAC Name | 1-(2,3-dichlorophenyl)sulfonylpiperidine |
| SMILES | O=S(=O)(c1cccc(Cl)c1Cl)N1CCCCC1 |
| InChI | InChI=1S/C11H13Cl2NO2S/c12-9-5-4-6-10(11(9)13)17(15,16)14-7-2-1-3-8-14/h4-6H,1-3,7-8H2 |
| InChIKey | BDWQNWHYBAQWCN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.20 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |