C11H13Cl3N2O2S — CID 775505
1-methyl-4-(2,4,5-trichlorophenyl)sulfonylpiperazine (PubChem CID 775505) has the molecular formula C11H13Cl3N2O2S and a molecular weight of 343.66 g/mol. Its IUPAC name is 1-methyl-4-(2,4,5-trichlorophenyl)sulfonylpiperazine.
| Compound Name | 1-methyl-4-(2,4,5-trichlorophenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 775505 |
| Molecular Formula | C11H13Cl3N2O2S |
| Molecular Weight | 343.66 g/mol |
| Exact Mass | 341.98 |
| IUPAC Name | 1-methyl-4-(2,4,5-trichlorophenyl)sulfonylpiperazine |
| SMILES | CN1CCN(S(=O)(=O)c2cc(Cl)c(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C11H13Cl3N2O2S/c1-15-2-4-16(5-3-15)19(17,18)11-7-9(13)8(12)6-10(11)14/h6-7H,2-5H2,1H3 |
| InChIKey | SSHZBEZDKVHQGK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.66 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|