C14H9NO4S2 — CID 2809916
methyl 3-(2,5-dioxopyrrol-1-yl)-5-thiophen-2-ylthiophene-2-carboxylate (PubChem CID 2809916) has the molecular formula C14H9NO4S2 and a molecular weight of 319.36 g/mol. Its IUPAC name is methyl 3-(2,5-dioxopyrrol-1-yl)-5-thiophen-2-ylthiophene-2-carboxylate.
| Compound Name | methyl 3-(2,5-dioxopyrrol-1-yl)-5-thiophen-2-ylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 2809916 |
| Molecular Formula | C14H9NO4S2 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.00 |
| IUPAC Name | methyl 3-(2,5-dioxopyrrol-1-yl)-5-thiophen-2-ylthiophene-2-carboxylate |
| SMILES | COC(=O)c1sc(-c2cccs2)cc1N1C(=O)C=CC1=O |
| InChI | InChI=1S/C14H9NO4S2/c1-19-14(18)13-8(15-11(16)4-5-12(15)17)7-10(21-13)9-3-2-6-20-9/h2-7H,1H3 |
| InChIKey | OCJSEDSTCFVYNC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|