C17H17N3OS — CID 2814456
N-benzyl-N-propan-2-yl-2,1,3-benzothiadiazole-5-carboxamide (PubChem CID 2814456) has the molecular formula C17H17N3OS and a molecular weight of 311.41 g/mol. Its IUPAC name is N-benzyl-N-propan-2-yl-2,1,3-benzothiadiazole-5-carboxamide.
| Compound Name | N-benzyl-N-propan-2-yl-2,1,3-benzothiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 2814456 |
| Molecular Formula | C17H17N3OS |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | N-benzyl-N-propan-2-yl-2,1,3-benzothiadiazole-5-carboxamide |
| SMILES | CC(C)N(Cc1ccccc1)C(=O)c1ccc2nsnc2c1 |
| InChI | InChI=1S/C17H17N3OS/c1-12(2)20(11-13-6-4-3-5-7-13)17(21)14-8-9-15-16(10-14)19-22-18-15/h3-10,12H,11H2,1-2H3 |
| InChIKey | ZGLHPODXMONVOJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |