About N-methyl-N-(oxan-4-yl)-2,1,3-benzoxadiazole-5-carboxamide
N-methyl-N-(oxan-4-yl)-2,1,3-benzoxadiazole-5-carboxamide (PubChem CID 25104045) has the molecular formula C13H15N3O3
and a molecular weight of 261.28 g/mol. Its IUPAC name is N-methyl-N-(oxan-4-yl)-2,1,3-benzoxadiazole-5-carboxamide.
Molecular Properties
| Compound Name | N-methyl-N-(oxan-4-yl)-2,1,3-benzoxadiazole-5-carboxamide |
| PubChem CID | 25104045 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | N-methyl-N-(oxan-4-yl)-2,1,3-benzoxadiazole-5-carboxamide |
| SMILES | CN(C(=O)c1ccc2nonc2c1)C1CCOCC1 |
| InChI | InChI=1S/C13H15N3O3/c1-16(10-4-6-18-7-5-10)13(17)9-2-3-11-12(8-9)15-19-14-11/h2-3,8,10H,4-7H2,1H3 |
| InChIKey | IRYRMRDDVXULFG-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-methyl-N-(oxan-4-yl)-2,1,3-benzoxadiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-(oxan-4-yl)-2,1,3-benzoxadiazole-5-carboxamide?
The IUPAC name of N-methyl-N-(oxan-4-yl)-2,1,3-benzoxadiazole-5-carboxamide (CID 25104045) is N-methyl-N-(oxan-4-yl)-2,1,3-benzoxadiazole-5-carboxamide.
What is the SMILES notation for N-methyl-N-(oxan-4-yl)-2,1,3-benzoxadiazole-5-carboxamide?
The canonical SMILES for N-methyl-N-(oxan-4-yl)-2,1,3-benzoxadiazole-5-carboxamide is CN(C(=O)c1ccc2nonc2c1)C1CCOCC1.
What is the InChIKey of N-methyl-N-(oxan-4-yl)-2,1,3-benzoxadiazole-5-carboxamide?
The InChIKey is IRYRMRDDVXULFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O3/c1-16(10-4-6-18-7-5-10)13(17)9-2-3-11-12(8-9)15-19-14-11/h2-3,8,10H,4-7H2,1H3.
What are the key properties of N-methyl-N-(oxan-4-yl)-2,1,3-benzoxadiazole-5-carboxamide?
N-methyl-N-(oxan-4-yl)-2,1,3-benzoxadiazole-5-carboxamide has a molecular weight of 261.28 g/mol, XLogP of 1.47, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-(oxan-4-yl)-2,1,3-benzoxadiazole-5-carboxamide is sourced from PubChem (CID 25104045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).