C13H15N3O3 — CID 25104045
N-methyl-N-(oxan-4-yl)-2,1,3-benzoxadiazole-5-carboxamide (PubChem CID 25104045) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is N-methyl-N-(oxan-4-yl)-2,1,3-benzoxadiazole-5-carboxamide.
| Compound Name | N-methyl-N-(oxan-4-yl)-2,1,3-benzoxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 25104045 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | N-methyl-N-(oxan-4-yl)-2,1,3-benzoxadiazole-5-carboxamide |
| SMILES | CN(C(=O)c1ccc2nonc2c1)C1CCOCC1 |
| InChI | InChI=1S/C13H15N3O3/c1-16(10-4-6-18-7-5-10)13(17)9-2-3-11-12(8-9)15-19-14-11/h2-3,8,10H,4-7H2,1H3 |
| InChIKey | IRYRMRDDVXULFG-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |