C11H13N3O3 — CID 10421572
N-butyl-3-oxido-2,1,3-benzoxadiazol-3-ium-5-carboxamide (PubChem CID 10421572) has the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. Its IUPAC name is N-butyl-3-oxido-2,1,3-benzoxadiazol-3-ium-5-carboxamide.
| Compound Name | N-butyl-3-oxido-2,1,3-benzoxadiazol-3-ium-5-carboxamide |
|---|---|
| PubChem CID | 10421572 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | N-butyl-3-oxido-2,1,3-benzoxadiazol-3-ium-5-carboxamide |
| SMILES | CCCCNC(=O)c1ccc2no[n+]([O-])c2c1 |
| InChI | InChI=1S/C11H13N3O3/c1-2-3-6-12-11(15)8-4-5-9-10(7-8)14(16)17-13-9/h4-5,7H,2-3,6H2,1H3,(H,12,15) |
| InChIKey | KEKGMNQODRGSJB-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 82.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|