About 4-[4-[4-(1-adamantyl)-1,3-thiazol-2-yl]phenyl]thiadiazole
4-[4-[4-(1-adamantyl)-1,3-thiazol-2-yl]phenyl]thiadiazole (PubChem CID 2815210) has the molecular formula C21H21N3S2
and a molecular weight of 379.55 g/mol. Its IUPAC name is 4-[4-[4-(1-adamantyl)-1,3-thiazol-2-yl]phenyl]thiadiazole.
Molecular Properties
| Compound Name | 4-[4-[4-(1-adamantyl)-1,3-thiazol-2-yl]phenyl]thiadiazole |
| PubChem CID | 2815210 |
| Molecular Formula | C21H21N3S2 |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 4-[4-[4-(1-adamantyl)-1,3-thiazol-2-yl]phenyl]thiadiazole |
| SMILES | c1cc(-c2nc(C34CC5CC(CC(C5)C3)C4)cs2)ccc1-c1csnn1 |
| InChI | InChI=1S/C21H21N3S2/c1-3-17(4-2-16(1)18-11-26-24-23-18)20-22-19(12-25-20)21-8-13-5-14(9-21)7-15(6-13)10-21/h1-4,11-15H,5-10H2 |
| InChIKey | SDMVIYDMZNTOGP-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[4-[4-(1-adamantyl)-1,3-thiazol-2-yl]phenyl]thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[4-(1-adamantyl)-1,3-thiazol-2-yl]phenyl]thiadiazole?
The IUPAC name of 4-[4-[4-(1-adamantyl)-1,3-thiazol-2-yl]phenyl]thiadiazole (CID 2815210) is 4-[4-[4-(1-adamantyl)-1,3-thiazol-2-yl]phenyl]thiadiazole.
What is the SMILES notation for 4-[4-[4-(1-adamantyl)-1,3-thiazol-2-yl]phenyl]thiadiazole?
The canonical SMILES for 4-[4-[4-(1-adamantyl)-1,3-thiazol-2-yl]phenyl]thiadiazole is c1cc(-c2nc(C34CC5CC(CC(C5)C3)C4)cs2)ccc1-c1csnn1.
What is the InChIKey of 4-[4-[4-(1-adamantyl)-1,3-thiazol-2-yl]phenyl]thiadiazole?
The InChIKey is SDMVIYDMZNTOGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N3S2/c1-3-17(4-2-16(1)18-11-26-24-23-18)20-22-19(12-25-20)21-8-13-5-14(9-21)7-15(6-13)10-21/h1-4,11-15H,5-10H2.
What are the key properties of 4-[4-[4-(1-adamantyl)-1,3-thiazol-2-yl]phenyl]thiadiazole?
4-[4-[4-(1-adamantyl)-1,3-thiazol-2-yl]phenyl]thiadiazole has a molecular weight of 379.55 g/mol, XLogP of 5.80, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[4-(1-adamantyl)-1,3-thiazol-2-yl]phenyl]thiadiazole is sourced from PubChem (CID 2815210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).