C21H21N3S2 — CID 2815210
4-[4-[4-(1-adamantyl)-1,3-thiazol-2-yl]phenyl]thiadiazole (PubChem CID 2815210) has the molecular formula C21H21N3S2 and a molecular weight of 379.55 g/mol. Its IUPAC name is 4-[4-[4-(1-adamantyl)-1,3-thiazol-2-yl]phenyl]thiadiazole.
| Compound Name | 4-[4-[4-(1-adamantyl)-1,3-thiazol-2-yl]phenyl]thiadiazole |
|---|---|
| PubChem CID | 2815210 |
| Molecular Formula | C21H21N3S2 |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 4-[4-[4-(1-adamantyl)-1,3-thiazol-2-yl]phenyl]thiadiazole |
| SMILES | c1cc(-c2nc(C34CC5CC(CC(C5)C3)C4)cs2)ccc1-c1csnn1 |
| InChI | InChI=1S/C21H21N3S2/c1-3-17(4-2-16(1)18-11-26-24-23-18)20-22-19(12-25-20)21-8-13-5-14(9-21)7-15(6-13)10-21/h1-4,11-15H,5-10H2 |
| InChIKey | SDMVIYDMZNTOGP-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |