C16H12N4O3S — CID 2816503
3-amino-4-(furan-2-yl)-6-thiophen-2-ylfuro[2,3-b]pyridine-2-carbohydrazide (PubChem CID 2816503) has the molecular formula C16H12N4O3S and a molecular weight of 340.36 g/mol. Its IUPAC name is 3-amino-4-(furan-2-yl)-6-thiophen-2-ylfuro[2,3-b]pyridine-2-carbohydrazide.
| Compound Name | 3-amino-4-(furan-2-yl)-6-thiophen-2-ylfuro[2,3-b]pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 2816503 |
| Molecular Formula | C16H12N4O3S |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 3-amino-4-(furan-2-yl)-6-thiophen-2-ylfuro[2,3-b]pyridine-2-carbohydrazide |
| SMILES | NNC(=O)c1oc2nc(-c3cccs3)cc(-c3ccco3)c2c1N |
| InChI | InChI=1S/C16H12N4O3S/c17-13-12-8(10-3-1-5-22-10)7-9(11-4-2-6-24-11)19-16(12)23-14(13)15(21)20-18/h1-7H,17-18H2,(H,20,21) |
| InChIKey | SRCFFETXIPCCFE-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 120.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|