C26H21N5O3S — CID 2816099
1-[[3-amino-4-(furan-2-yl)-6-(4-methylphenyl)furo[2,3-b]pyridine-2-carbonyl]amino]-3-phenylthiourea (PubChem CID 2816099) has the molecular formula C26H21N5O3S and a molecular weight of 483.55 g/mol. Its IUPAC name is 1-[[3-amino-4-(furan-2-yl)-6-(4-methylphenyl)furo[2,3-b]pyridine-2-carbonyl]amino]-3-phenylthiourea.
| Compound Name | 1-[[3-amino-4-(furan-2-yl)-6-(4-methylphenyl)furo[2,3-b]pyridine-2-carbonyl]amino]-3-phenylthiourea |
|---|---|
| PubChem CID | 2816099 |
| Molecular Formula | C26H21N5O3S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | 1-[[3-amino-4-(furan-2-yl)-6-(4-methylphenyl)furo[2,3-b]pyridine-2-carbonyl]amino]-3-phenylthiourea |
| SMILES | Cc1ccc(-c2cc(-c3ccco3)c3c(N)c(C(=O)NNC(=S)Nc4ccccc4)oc3n2)cc1 |
| InChI | InChI=1S/C26H21N5O3S/c1-15-9-11-16(12-10-15)19-14-18(20-8-5-13-33-20)21-22(27)23(34-25(21)29-19)24(32)30-31-26(35)28-17-6-3-2-4-7-17/h2-14H,27H2,1H3,(H,30,32)(H2,28,31,35) |
| InChIKey | JLEQVSSEPYQSMW-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 118.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|