C26H34N2O3S — CID 2818612
ethyl 4-[[morpholin-4-yl-[(2,3,4,5,6-pentamethylphenyl)methylsulfanyl]methylidene]amino]benzoate (PubChem CID 2818612) has the molecular formula C26H34N2O3S and a molecular weight of 454.64 g/mol. Its IUPAC name is ethyl 4-[[morpholin-4-yl-[(2,3,4,5,6-pentamethylphenyl)methylsulfanyl]methylidene]amino]benzoate.
| Compound Name | ethyl 4-[[morpholin-4-yl-[(2,3,4,5,6-pentamethylphenyl)methylsulfanyl]methylidene]amino]benzoate |
|---|---|
| PubChem CID | 2818612 |
| Molecular Formula | C26H34N2O3S |
| Molecular Weight | 454.64 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | ethyl 4-[[morpholin-4-yl-[(2,3,4,5,6-pentamethylphenyl)methylsulfanyl]methylidene]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(/N=C(/SCc2c(C)c(C)c(C)c(C)c2C)N2CCOCC2)cc1 |
| InChI | InChI=1S/C26H34N2O3S/c1-7-31-25(29)22-8-10-23(11-9-22)27-26(28-12-14-30-15-13-28)32-16-24-20(5)18(3)17(2)19(4)21(24)6/h8-11H,7,12-16H2,1-6H3/b27-26+ |
| InChIKey | VAPDVYKKHOFDLG-CYYJNZCTSA-N |
| XLogP | 5.66 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.64 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|