C19H15ClF3N5O2S — CID 2819970
[[amino-[3-[[4-methyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]phenyl]methylidene]amino] 4-chlorobenzoate (PubChem CID 2819970) has the molecular formula C19H15ClF3N5O2S and a molecular weight of 469.88 g/mol. Its IUPAC name is [[amino-[3-[[4-methyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]phenyl]methylidene]amino] 4-chlorobenzoate.
| Compound Name | [[amino-[3-[[4-methyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]phenyl]methylidene]amino] 4-chlorobenzoate |
|---|---|
| PubChem CID | 2819970 |
| Molecular Formula | C19H15ClF3N5O2S |
| Molecular Weight | 469.88 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | [[amino-[3-[[4-methyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]phenyl]methylidene]amino] 4-chlorobenzoate |
| SMILES | Cn1c(SCc2cccc(C(N)=NOC(=O)c3ccc(Cl)cc3)c2)nnc1C(F)(F)F |
| InChI | InChI=1S/C19H15ClF3N5O2S/c1-28-17(19(21,22)23)25-26-18(28)31-10-11-3-2-4-13(9-11)15(24)27-30-16(29)12-5-7-14(20)8-6-12/h2-9H,10H2,1H3,(H2,24,27) |
| InChIKey | BMHSALXAHKMLCM-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 95.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.88 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|