C22H19F3N2OS2 — CID 2821894
2-[[4-butoxy-2-(trifluoromethyl)quinolin-6-yl]methylsulfanyl]-1,3-benzothiazole (PubChem CID 2821894) has the molecular formula C22H19F3N2OS2 and a molecular weight of 448.54 g/mol. Its IUPAC name is 2-[[4-butoxy-2-(trifluoromethyl)quinolin-6-yl]methylsulfanyl]-1,3-benzothiazole.
| Compound Name | 2-[[4-butoxy-2-(trifluoromethyl)quinolin-6-yl]methylsulfanyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 2821894 |
| Molecular Formula | C22H19F3N2OS2 |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | 2-[[4-butoxy-2-(trifluoromethyl)quinolin-6-yl]methylsulfanyl]-1,3-benzothiazole |
| SMILES | CCCCOc1cc(C(F)(F)F)nc2ccc(CSc3nc4ccccc4s3)cc12 |
| InChI | InChI=1S/C22H19F3N2OS2/c1-2-3-10-28-18-12-20(22(23,24)25)26-16-9-8-14(11-15(16)18)13-29-21-27-17-6-4-5-7-19(17)30-21/h4-9,11-12H,2-3,10,13H2,1H3 |
| InChIKey | NOTMZAIXVIGWDK-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|