C24H21NOS2 — CID 72703281
2-[(E)-4-(4-phenylmethoxyphenyl)but-3-enyl]sulfanyl-1,3-benzothiazole (PubChem CID 72703281) has the molecular formula C24H21NOS2 and a molecular weight of 403.57 g/mol. Its IUPAC name is 2-[(E)-4-(4-phenylmethoxyphenyl)but-3-enyl]sulfanyl-1,3-benzothiazole.
| Compound Name | 2-[(E)-4-(4-phenylmethoxyphenyl)but-3-enyl]sulfanyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 72703281 |
| Molecular Formula | C24H21NOS2 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 2-[(E)-4-(4-phenylmethoxyphenyl)but-3-enyl]sulfanyl-1,3-benzothiazole |
| SMILES | C(=C/c1ccc(OCc2ccccc2)cc1)\CCSc1nc2ccccc2s1 |
| InChI | InChI=1S/C24H21NOS2/c1-2-9-20(10-3-1)18-26-21-15-13-19(14-16-21)8-6-7-17-27-24-25-22-11-4-5-12-23(22)28-24/h1-6,8-16H,7,17-18H2/b8-6+ |
| InChIKey | BOCYCBTYVDQSSL-SOFGYWHQSA-N |
| XLogP | 7.07 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|