C16H28NO+ — CID 2828546
1-methyl-1-[(8-methyl-3-oxabicyclo[3.3.1]non-7-en-2-yl)methyl]piperidin-1-ium (PubChem CID 2828546) has the molecular formula C16H28NO+ and a molecular weight of 250.41 g/mol. Its IUPAC name is 1-methyl-1-[(8-methyl-3-oxabicyclo[3.3.1]non-7-en-2-yl)methyl]piperidin-1-ium.
| Compound Name | 1-methyl-1-[(8-methyl-3-oxabicyclo[3.3.1]non-7-en-2-yl)methyl]piperidin-1-ium |
|---|---|
| PubChem CID | 2828546 |
| Molecular Formula | C16H28NO+ |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.22 |
| IUPAC Name | 1-methyl-1-[(8-methyl-3-oxabicyclo[3.3.1]non-7-en-2-yl)methyl]piperidin-1-ium |
| SMILES | CC1=CCC2COC(C[N+]3(C)CCCCC3)C1C2 |
| InChI | InChI=1S/C16H28NO/c1-13-6-7-14-10-15(13)16(18-12-14)11-17(2)8-4-3-5-9-17/h6,14-16H,3-5,7-12H2,1-2H3/q+1 |
| InChIKey | ZPZRJVRZBUVASI-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|