About 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethan-1-amine
2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethan-1-amine (PubChem CID 28293777) has the molecular formula C7H15NO2
and a molecular weight of 145.20 g/mol. Its IUPAC name is 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanamine.
Analyze 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethan-1-amine?
The IUPAC name of 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethan-1-amine (CID 28293777) is 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanamine.
What is the SMILES notation for 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethan-1-amine?
The canonical SMILES for 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethan-1-amine is CC1(OC[C@@H](O1)CCN)C.
What is the InChIKey of 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethan-1-amine?
The InChIKey is YBYAUYKHQWYPSD-LURJTMIESA-N. The full InChI is InChI=1S/C7H15NO2/c1-7(2)9-5-6(10-7)3-4-8/h6H,3-5,8H2,1-2H3/t6-/m0/s1.
What are the key properties of 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethan-1-amine?
2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethan-1-amine has a molecular weight of 145.20 g/mol, XLogP of -0.10, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethan-1-amine is sourced from PubChem (CID 28293777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).