C15H21NO7S — CID 2829837
oxalic acid;phenyl 2-piperidin-1-ylethanesulfonate (PubChem CID 2829837) has the molecular formula C15H21NO7S and a molecular weight of 359.40 g/mol. Its IUPAC name is oxalic acid;phenyl 2-piperidin-1-ylethanesulfonate.
| Compound Name | oxalic acid;phenyl 2-piperidin-1-ylethanesulfonate |
|---|---|
| PubChem CID | 2829837 |
| Molecular Formula | C15H21NO7S |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | oxalic acid;phenyl 2-piperidin-1-ylethanesulfonate |
| SMILES | O=C(O)C(=O)O.O=S(=O)(CCN1CCCCC1)Oc1ccccc1 |
| InChI | InChI=1S/C13H19NO3S.C2H2O4/c15-18(16,17-13-7-3-1-4-8-13)12-11-14-9-5-2-6-10-14;3-1(4)2(5)6/h1,3-4,7-8H,2,5-6,9-12H2;(H,3,4)(H,5,6) |
| InChIKey | JTESTEMGXJBLBI-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 121.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|