C22H16Br2ClNO4 — CID 2835899
[2,4-dibromo-6-[[(2-chlorobenzoyl)amino]methyl]phenyl] 2-phenoxyacetate (PubChem CID 2835899) has the molecular formula C22H16Br2ClNO4 and a molecular weight of 553.63 g/mol. Its IUPAC name is [2,4-dibromo-6-[[(2-chlorobenzoyl)amino]methyl]phenyl] 2-phenoxyacetate.
| Compound Name | [2,4-dibromo-6-[[(2-chlorobenzoyl)amino]methyl]phenyl] 2-phenoxyacetate |
|---|---|
| PubChem CID | 2835899 |
| Molecular Formula | C22H16Br2ClNO4 |
| Molecular Weight | 553.63 g/mol |
| Exact Mass | 550.91 |
| IUPAC Name | [2,4-dibromo-6-[[(2-chlorobenzoyl)amino]methyl]phenyl] 2-phenoxyacetate |
| SMILES | O=C(COc1ccccc1)Oc1c(Br)cc(Br)cc1CNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C22H16Br2ClNO4/c23-15-10-14(12-26-22(28)17-8-4-5-9-19(17)25)21(18(24)11-15)30-20(27)13-29-16-6-2-1-3-7-16/h1-11H,12-13H2,(H,26,28) |
| InChIKey | NPBLUVQMRYMECM-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.63 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|