C17H13Cl4NO3 — CID 2243918
[3,4,6-trichloro-2-[[(2-chlorobenzoyl)amino]methyl]phenyl] propanoate (PubChem CID 2243918) has the molecular formula C17H13Cl4NO3 and a molecular weight of 421.11 g/mol. Its IUPAC name is [3,4,6-trichloro-2-[[(2-chlorobenzoyl)amino]methyl]phenyl] propanoate.
| Compound Name | [3,4,6-trichloro-2-[[(2-chlorobenzoyl)amino]methyl]phenyl] propanoate |
|---|---|
| PubChem CID | 2243918 |
| Molecular Formula | C17H13Cl4NO3 |
| Molecular Weight | 421.11 g/mol |
| Exact Mass | 418.96 |
| IUPAC Name | [3,4,6-trichloro-2-[[(2-chlorobenzoyl)amino]methyl]phenyl] propanoate |
| SMILES | CCC(=O)Oc1c(Cl)cc(Cl)c(Cl)c1CNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C17H13Cl4NO3/c1-2-14(23)25-16-10(15(21)12(19)7-13(16)20)8-22-17(24)9-5-3-4-6-11(9)18/h3-7H,2,8H2,1H3,(H,22,24) |
| InChIKey | XXVPDYMGBUENKI-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.11 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|