C9H12N4O4 — CID 2837741
5-hydroxyimino-4-(2-hydroxyiminopropyl)-6,7-dihydro-2,1,3-benzoxadiazol-4-ol (PubChem CID 2837741) has the molecular formula C9H12N4O4 and a molecular weight of 240.22 g/mol. Its IUPAC name is 5-hydroxyimino-4-(2-hydroxyiminopropyl)-6,7-dihydro-2,1,3-benzoxadiazol-4-ol.
| Compound Name | 5-hydroxyimino-4-(2-hydroxyiminopropyl)-6,7-dihydro-2,1,3-benzoxadiazol-4-ol |
|---|---|
| PubChem CID | 2837741 |
| Molecular Formula | C9H12N4O4 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 5-hydroxyimino-4-(2-hydroxyiminopropyl)-6,7-dihydro-2,1,3-benzoxadiazol-4-ol |
| SMILES | CC(CC1(O)C(=NO)CCc2nonc21)=NO |
| InChI | InChI=1S/C9H12N4O4/c1-5(10-15)4-9(14)7(11-16)3-2-6-8(9)13-17-12-6/h14-16H,2-4H2,1H3 |
| InChIKey | FDEIDFRJDUVOMZ-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 124.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|