3-(furan-2-ylmethylsulfamoyl)-2,2-dimethylpropanoic acid

C10H15NO5S — CID 28515608

IUPAC3-(furan-2-ylmethylsulfamoyl)-2,2-dimethylpropanoic acid
SMILESCC(C)(CS(=O)(=O)NCc1ccco1)C(=O)O
InChIInChI=1S/C10H15NO5S/c1-10(2,9(12)13)7-17(14,15)11-6-8-4-3-5-16-8/h3-5,11H,6-7H2,1-2H3,(H,12,13)
InChIKeyAXSVICZILOOKFR-UHFFFAOYSA-N
MW261.30 g/mol
LogP0.81
Rot. Bonds6

About 3-(furan-2-ylmethylsulfamoyl)-2,2-dimethylpropanoic acid

3-(furan-2-ylmethylsulfamoyl)-2,2-dimethylpropanoic acid (PubChem CID 28515608) has the molecular formula C10H15NO5S and a molecular weight of 261.30 g/mol. Its IUPAC name is 3-(furan-2-ylmethylsulfamoyl)-2,2-dimethylpropanoic acid.

Molecular Properties

Compound Name3-(furan-2-ylmethylsulfamoyl)-2,2-dimethylpropanoic acid
PubChem CID28515608
Molecular FormulaC10H15NO5S
Molecular Weight261.30 g/mol
Exact Mass261.07
IUPAC Name3-(furan-2-ylmethylsulfamoyl)-2,2-dimethylpropanoic acid
SMILESCC(C)(CS(=O)(=O)NCc1ccco1)C(=O)O
InChIInChI=1S/C10H15NO5S/c1-10(2,9(12)13)7-17(14,15)11-6-8-4-3-5-16-8/h3-5,11H,6-7H2,1-2H3,(H,12,13)
InChIKeyAXSVICZILOOKFR-UHFFFAOYSA-N
XLogP0.81
TPSA96.61 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500261.30
LogP ≤ 50.81
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3-(furan-2-ylmethylsulfamoyl)-2,2-dimethylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(furan-2-ylmethylsulfamoyl)-2,2-dimethylpropanoic acid?
The IUPAC name of 3-(furan-2-ylmethylsulfamoyl)-2,2-dimethylpropanoic acid (CID 28515608) is 3-(furan-2-ylmethylsulfamoyl)-2,2-dimethylpropanoic acid.
What is the SMILES notation for 3-(furan-2-ylmethylsulfamoyl)-2,2-dimethylpropanoic acid?
The canonical SMILES for 3-(furan-2-ylmethylsulfamoyl)-2,2-dimethylpropanoic acid is CC(C)(CS(=O)(=O)NCc1ccco1)C(=O)O.
What is the InChIKey of 3-(furan-2-ylmethylsulfamoyl)-2,2-dimethylpropanoic acid?
The InChIKey is AXSVICZILOOKFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO5S/c1-10(2,9(12)13)7-17(14,15)11-6-8-4-3-5-16-8/h3-5,11H,6-7H2,1-2H3,(H,12,13).
What are the key properties of 3-(furan-2-ylmethylsulfamoyl)-2,2-dimethylpropanoic acid?
3-(furan-2-ylmethylsulfamoyl)-2,2-dimethylpropanoic acid has a molecular weight of 261.30 g/mol, XLogP of 0.81, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(furan-2-ylmethylsulfamoyl)-2,2-dimethylpropanoic acid is sourced from PubChem (CID 28515608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).