C14H18NO5P — CID 2854370
2-[hydroxy-[(2-oxopyrrolidin-1-yl)methyl]phosphoryl]-3-phenylpropanoic acid (PubChem CID 2854370) has the molecular formula C14H18NO5P and a molecular weight of 311.27 g/mol. Its IUPAC name is 2-[hydroxy-[(2-oxopyrrolidin-1-yl)methyl]phosphoryl]-3-phenylpropanoic acid.
| Compound Name | 2-[hydroxy-[(2-oxopyrrolidin-1-yl)methyl]phosphoryl]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 2854370 |
| Molecular Formula | C14H18NO5P |
| Molecular Weight | 311.27 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 2-[hydroxy-[(2-oxopyrrolidin-1-yl)methyl]phosphoryl]-3-phenylpropanoic acid |
| SMILES | O=C(O)C(Cc1ccccc1)P(=O)(O)CN1CCCC1=O |
| InChI | InChI=1S/C14H18NO5P/c16-13-7-4-8-15(13)10-21(19,20)12(14(17)18)9-11-5-2-1-3-6-11/h1-3,5-6,12H,4,7-10H2,(H,17,18)(H,19,20) |
| InChIKey | XHUZUZQHNKAOQP-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.27 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|