C14H19NO6P- — CID 7367506
(2R)-3-(furan-2-yl)-2-[hydroxy-[(2-oxoazepan-1-yl)methyl]phosphoryl]propanoate (PubChem CID 7367506) has the molecular formula C14H19NO6P- and a molecular weight of 328.28 g/mol. Its IUPAC name is (2R)-3-(furan-2-yl)-2-[hydroxy-[(2-oxoazepan-1-yl)methyl]phosphoryl]propanoate.
| Compound Name | (2R)-3-(furan-2-yl)-2-[hydroxy-[(2-oxoazepan-1-yl)methyl]phosphoryl]propanoate |
|---|---|
| PubChem CID | 7367506 |
| Molecular Formula | C14H19NO6P- |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | (2R)-3-(furan-2-yl)-2-[hydroxy-[(2-oxoazepan-1-yl)methyl]phosphoryl]propanoate |
| SMILES | O=C([O-])[C@@H](Cc1ccco1)P(=O)(O)CN1CCCCCC1=O |
| InChI | InChI=1S/C14H20NO6P/c16-13-6-2-1-3-7-15(13)10-22(19,20)12(14(17)18)9-11-5-4-8-21-11/h4-5,8,12H,1-3,6-7,9-10H2,(H,17,18)(H,19,20)/p-1/t12-/m1/s1 |
| InChIKey | SGNIYHCKWUQXKT-GFCCVEGCSA-M |
| XLogP | 0.57 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|