C10H14NO5P-2 — CID 3362643
2-[(dimethylamino)methyl-oxidophosphoryl]-3-(furan-2-yl)propanoate (PubChem CID 3362643) has the molecular formula C10H14NO5P-2 and a molecular weight of 259.20 g/mol. Its IUPAC name is 2-[(dimethylamino)methyl-oxidophosphoryl]-3-(furan-2-yl)propanoate.
| Compound Name | 2-[(dimethylamino)methyl-oxidophosphoryl]-3-(furan-2-yl)propanoate |
|---|---|
| PubChem CID | 3362643 |
| Molecular Formula | C10H14NO5P-2 |
| Molecular Weight | 259.20 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 2-[(dimethylamino)methyl-oxidophosphoryl]-3-(furan-2-yl)propanoate |
| SMILES | CN(C)CP(=O)([O-])C(Cc1ccco1)C(=O)[O-] |
| InChI | InChI=1S/C10H16NO5P/c1-11(2)7-17(14,15)9(10(12)13)6-8-4-3-5-16-8/h3-5,9H,6-7H2,1-2H3,(H,12,13)(H,14,15)/p-2 |
| InChIKey | IVDNRJXRPBCLTL-UHFFFAOYSA-L |
| XLogP | -0.90 |
| TPSA | 96.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.20 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|