C12H15NO6P- — CID 6985209
(2R)-3-(furan-2-yl)-2-[hydroxy-[(2-oxopyrrolidin-1-yl)methyl]phosphoryl]propanoate (PubChem CID 6985209) has the molecular formula C12H15NO6P- and a molecular weight of 300.23 g/mol. Its IUPAC name is (2R)-3-(furan-2-yl)-2-[hydroxy-[(2-oxopyrrolidin-1-yl)methyl]phosphoryl]propanoate.
| Compound Name | (2R)-3-(furan-2-yl)-2-[hydroxy-[(2-oxopyrrolidin-1-yl)methyl]phosphoryl]propanoate |
|---|---|
| PubChem CID | 6985209 |
| Molecular Formula | C12H15NO6P- |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | (2R)-3-(furan-2-yl)-2-[hydroxy-[(2-oxopyrrolidin-1-yl)methyl]phosphoryl]propanoate |
| SMILES | O=C([O-])[C@@H](Cc1ccco1)P(=O)(O)CN1CCCC1=O |
| InChI | InChI=1S/C12H16NO6P/c14-11-4-1-5-13(11)8-20(17,18)10(12(15)16)7-9-3-2-6-19-9/h2-3,6,10H,1,4-5,7-8H2,(H,15,16)(H,17,18)/p-1/t10-/m1/s1 |
| InChIKey | QXEQZJCLHZJHSJ-SNVBAGLBSA-M |
| XLogP | -0.21 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|