C10H13NO7P-3 — CID 4597985
2-[[oxido-[(2-oxopyrrolidin-1-yl)methyl]phosphoryl]methyl]butanedioate (PubChem CID 4597985) has the molecular formula C10H13NO7P-3 and a molecular weight of 290.19 g/mol. Its IUPAC name is 2-[[oxido-[(2-oxopyrrolidin-1-yl)methyl]phosphoryl]methyl]butanedioate.
| Compound Name | 2-[[oxido-[(2-oxopyrrolidin-1-yl)methyl]phosphoryl]methyl]butanedioate |
|---|---|
| PubChem CID | 4597985 |
| Molecular Formula | C10H13NO7P-3 |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 2-[[oxido-[(2-oxopyrrolidin-1-yl)methyl]phosphoryl]methyl]butanedioate |
| SMILES | O=C([O-])CC(CP(=O)([O-])CN1CCCC1=O)C(=O)[O-] |
| InChI | InChI=1S/C10H16NO7P/c12-8-2-1-3-11(8)6-19(17,18)5-7(10(15)16)4-9(13)14/h7H,1-6H2,(H,13,14)(H,15,16)(H,17,18)/p-3 |
| InChIKey | BFEZFTNKHILKBZ-UHFFFAOYSA-K |
| XLogP | -3.29 |
| TPSA | 140.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | -3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|