C13H18NO5P-2 — CID 3782681
3-(furan-2-yl)-2-[oxido(piperidin-1-ylmethyl)phosphoryl]propanoate (PubChem CID 3782681) has the molecular formula C13H18NO5P-2 and a molecular weight of 299.26 g/mol. Its IUPAC name is 3-(furan-2-yl)-2-[oxido(piperidin-1-ylmethyl)phosphoryl]propanoate.
| Compound Name | 3-(furan-2-yl)-2-[oxido(piperidin-1-ylmethyl)phosphoryl]propanoate |
|---|---|
| PubChem CID | 3782681 |
| Molecular Formula | C13H18NO5P-2 |
| Molecular Weight | 299.26 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 3-(furan-2-yl)-2-[oxido(piperidin-1-ylmethyl)phosphoryl]propanoate |
| SMILES | O=C([O-])C(Cc1ccco1)P(=O)([O-])CN1CCCCC1 |
| InChI | InChI=1S/C13H20NO5P/c15-13(16)12(9-11-5-4-8-19-11)20(17,18)10-14-6-2-1-3-7-14/h4-5,8,12H,1-3,6-7,9-10H2,(H,15,16)(H,17,18)/p-2 |
| InChIKey | JSZZIJUIFCDBLV-UHFFFAOYSA-L |
| XLogP | 0.02 |
| TPSA | 96.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.26 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|