C12H12N6O4S — CID 28559465
2-[(5R)-2-(diaminomethylideneamino)-4-oxo-1,3-thiazol-5-yl]-N-(3-nitrophenyl)acetamide (PubChem CID 28559465) has the molecular formula C12H12N6O4S and a molecular weight of 336.33 g/mol. Its IUPAC name is 2-[(5R)-2-(diaminomethylideneamino)-4-oxo-1,3-thiazol-5-yl]-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-[(5R)-2-(diaminomethylideneamino)-4-oxo-1,3-thiazol-5-yl]-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 28559465 |
| Molecular Formula | C12H12N6O4S |
| Molecular Weight | 336.33 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 2-[(5R)-2-(diaminomethylideneamino)-4-oxo-1,3-thiazol-5-yl]-N-(3-nitrophenyl)acetamide |
| SMILES | NC(N)=NC1=NC(=O)[C@@H](CC(=O)Nc2cccc([N+](=O)[O-])c2)S1 |
| InChI | InChI=1S/C12H12N6O4S/c13-11(14)17-12-16-10(20)8(23-12)5-9(19)15-6-2-1-3-7(4-6)18(21)22/h1-4,8H,5H2,(H,15,19)(H4,13,14,16,17,20)/t8-/m1/s1 |
| InChIKey | QBYMYKDJFVQQSM-MRVPVSSYSA-N |
| XLogP | 0.19 |
| TPSA | 166.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.33 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|