C12H11Cl2N5O2S — CID 29102657
2-[(5R)-2-(diaminomethylideneamino)-4-oxo-1,3-thiazol-5-yl]-N-(2,5-dichlorophenyl)acetamide (PubChem CID 29102657) has the molecular formula C12H11Cl2N5O2S and a molecular weight of 360.23 g/mol. Its IUPAC name is 2-[(5R)-2-(diaminomethylideneamino)-4-oxo-1,3-thiazol-5-yl]-N-(2,5-dichlorophenyl)acetamide.
| Compound Name | 2-[(5R)-2-(diaminomethylideneamino)-4-oxo-1,3-thiazol-5-yl]-N-(2,5-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 29102657 |
| Molecular Formula | C12H11Cl2N5O2S |
| Molecular Weight | 360.23 g/mol |
| Exact Mass | 359.00 |
| IUPAC Name | 2-[(5R)-2-(diaminomethylideneamino)-4-oxo-1,3-thiazol-5-yl]-N-(2,5-dichlorophenyl)acetamide |
| SMILES | NC(N)=NC1=NC(=O)[C@@H](CC(=O)Nc2cc(Cl)ccc2Cl)S1 |
| InChI | InChI=1S/C12H11Cl2N5O2S/c13-5-1-2-6(14)7(3-5)17-9(20)4-8-10(21)18-12(22-8)19-11(15)16/h1-3,8H,4H2,(H,17,20)(H4,15,16,18,19,21)/t8-/m1/s1 |
| InChIKey | NMUZXAYTSVXXJL-MRVPVSSYSA-N |
| XLogP | 1.59 |
| TPSA | 122.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.23 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|