C13H12F3N5O2S — CID 17172612
2-[2-(diaminomethylideneamino)-4-oxo-1,3-thiazol-5-yl]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 17172612) has the molecular formula C13H12F3N5O2S and a molecular weight of 359.33 g/mol. Its IUPAC name is 2-[2-(diaminomethylideneamino)-4-oxo-1,3-thiazol-5-yl]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[2-(diaminomethylideneamino)-4-oxo-1,3-thiazol-5-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 17172612 |
| Molecular Formula | C13H12F3N5O2S |
| Molecular Weight | 359.33 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 2-[2-(diaminomethylideneamino)-4-oxo-1,3-thiazol-5-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | NC(N)=NC1=NC(=O)C(CC(=O)Nc2cccc(C(F)(F)F)c2)S1 |
| InChI | InChI=1S/C13H12F3N5O2S/c14-13(15,16)6-2-1-3-7(4-6)19-9(22)5-8-10(23)20-12(24-8)21-11(17)18/h1-4,8H,5H2,(H,19,22)(H4,17,18,20,21,23) |
| InChIKey | VSOBBUPITBKBKS-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 122.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.33 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|